About 3-oxa-7-thiatetracyclo[3.3.1.02,4.06,8]nonane
3-oxa-7-thiatetracyclo[3.3.1.02,4.06,8]nonane (PubChem CID 45120374) has the molecular formula C7H8OS
and a molecular weight of 140.21 g/mol. Its IUPAC name is 3-oxa-7-thiatetracyclo[3.3.1.02,4.06,8]nonane.
Molecular Properties
| Compound Name | 3-oxa-7-thiatetracyclo[3.3.1.02,4.06,8]nonane |
| PubChem CID | 45120374 |
| Molecular Formula | C7H8OS |
| Molecular Weight | 140.21 g/mol |
| Exact Mass | 140.03 |
| IUPAC Name | 3-oxa-7-thiatetracyclo[3.3.1.02,4.06,8]nonane |
| SMILES | C1C2C3OC3C1C1SC21 |
| InChI | InChI=1S/C7H8OS/c1-2-4-5(8-4)3(1)7-6(2)9-7/h2-7H,1H2 |
| InChIKey | BZBNWQNUOSSUQS-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.21 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-oxa-7-thiatetracyclo[3.3.1.02,4.06,8]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxa-7-thiatetracyclo[3.3.1.02,4.06,8]nonane?
The IUPAC name of 3-oxa-7-thiatetracyclo[3.3.1.02,4.06,8]nonane (CID 45120374) is 3-oxa-7-thiatetracyclo[3.3.1.02,4.06,8]nonane.
What is the SMILES notation for 3-oxa-7-thiatetracyclo[3.3.1.02,4.06,8]nonane?
The canonical SMILES for 3-oxa-7-thiatetracyclo[3.3.1.02,4.06,8]nonane is C1C2C3OC3C1C1SC21.
What is the InChIKey of 3-oxa-7-thiatetracyclo[3.3.1.02,4.06,8]nonane?
The InChIKey is BZBNWQNUOSSUQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8OS/c1-2-4-5(8-4)3(1)7-6(2)9-7/h2-7H,1H2.
What are the key properties of 3-oxa-7-thiatetracyclo[3.3.1.02,4.06,8]nonane?
3-oxa-7-thiatetracyclo[3.3.1.02,4.06,8]nonane has a molecular weight of 140.21 g/mol, XLogP of 0.89, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxa-7-thiatetracyclo[3.3.1.02,4.06,8]nonane is sourced from PubChem (CID 45120374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).