About 3-(1H-imidazol-5-yl)-1,2,4,5-tetrazine
3-(1H-imidazol-5-yl)-1,2,4,5-tetrazine (PubChem CID 45120622) has the molecular formula C5H4N6
and a molecular weight of 148.13 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)-1,2,4,5-tetrazine.
Molecular Properties
| Compound Name | 3-(1H-imidazol-5-yl)-1,2,4,5-tetrazine |
| PubChem CID | 45120622 |
| Molecular Formula | C5H4N6 |
| Molecular Weight | 148.13 g/mol |
| Exact Mass | 148.05 |
| IUPAC Name | 3-(1H-imidazol-5-yl)-1,2,4,5-tetrazine |
| SMILES | c1nnc(-c2cnc[nH]2)nn1 |
| InChI | InChI=1S/C5H4N6/c1-4(7-2-6-1)5-10-8-3-9-11-5/h1-3H,(H,6,7) |
| InChIKey | OBYGUUNHZABIFE-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.13 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(1H-imidazol-5-yl)-1,2,4,5-tetrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1H-imidazol-5-yl)-1,2,4,5-tetrazine?
The IUPAC name of 3-(1H-imidazol-5-yl)-1,2,4,5-tetrazine (CID 45120622) is 3-(1H-imidazol-5-yl)-1,2,4,5-tetrazine.
What is the SMILES notation for 3-(1H-imidazol-5-yl)-1,2,4,5-tetrazine?
The canonical SMILES for 3-(1H-imidazol-5-yl)-1,2,4,5-tetrazine is c1nnc(-c2cnc[nH]2)nn1.
What is the InChIKey of 3-(1H-imidazol-5-yl)-1,2,4,5-tetrazine?
The InChIKey is OBYGUUNHZABIFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N6/c1-4(7-2-6-1)5-10-8-3-9-11-5/h1-3H,(H,6,7).
What are the key properties of 3-(1H-imidazol-5-yl)-1,2,4,5-tetrazine?
3-(1H-imidazol-5-yl)-1,2,4,5-tetrazine has a molecular weight of 148.13 g/mol, XLogP of -0.34, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1H-imidazol-5-yl)-1,2,4,5-tetrazine is sourced from PubChem (CID 45120622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).