About 6-chloro-6,7-dihydro-3H-purine
6-chloro-6,7-dihydro-3H-purine (PubChem CID 45120637) has the molecular formula C5H5ClN4
and a molecular weight of 156.58 g/mol. Its IUPAC name is 6-chloro-6,7-dihydro-3H-purine.
Molecular Properties
| Compound Name | 6-chloro-6,7-dihydro-3H-purine |
| PubChem CID | 45120637 |
| Molecular Formula | C5H5ClN4 |
| Molecular Weight | 156.58 g/mol |
| Exact Mass | 156.02 |
| IUPAC Name | 6-chloro-6,7-dihydro-3H-purine |
| SMILES | ClC1N=CNc2nc[nH]c21 |
| InChI | InChI=1S/C5H5ClN4/c6-4-3-5(9-1-7-3)10-2-8-4/h1-2,4H,(H,7,9)(H,8,10) |
| InChIKey | ISYIJGDQPIOZHG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.58 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-6,7-dihydro-3H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-6,7-dihydro-3H-purine?
The IUPAC name of 6-chloro-6,7-dihydro-3H-purine (CID 45120637) is 6-chloro-6,7-dihydro-3H-purine.
What is the SMILES notation for 6-chloro-6,7-dihydro-3H-purine?
The canonical SMILES for 6-chloro-6,7-dihydro-3H-purine is ClC1N=CNc2nc[nH]c21.
What is the InChIKey of 6-chloro-6,7-dihydro-3H-purine?
The InChIKey is ISYIJGDQPIOZHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5ClN4/c6-4-3-5(9-1-7-3)10-2-8-4/h1-2,4H,(H,7,9)(H,8,10).
What are the key properties of 6-chloro-6,7-dihydro-3H-purine?
6-chloro-6,7-dihydro-3H-purine has a molecular weight of 156.58 g/mol, XLogP of 1.10, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-6,7-dihydro-3H-purine is sourced from PubChem (CID 45120637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).