About 3a,7a-dihydro-1H-imidazo[4,5-c]pyridin-4-amine
3a,7a-dihydro-1H-imidazo[4,5-c]pyridin-4-amine (PubChem CID 45120646) has the molecular formula C6H8N4
and a molecular weight of 136.16 g/mol. Its IUPAC name is 3a,7a-dihydro-1H-imidazo[4,5-c]pyridin-4-amine.
Molecular Properties
| Compound Name | 3a,7a-dihydro-1H-imidazo[4,5-c]pyridin-4-amine |
| PubChem CID | 45120646 |
| Molecular Formula | C6H8N4 |
| Molecular Weight | 136.16 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | 3a,7a-dihydro-1H-imidazo[4,5-c]pyridin-4-amine |
| SMILES | NC1=NC=CC2NC=NC12 |
| InChI | InChI=1S/C6H8N4/c7-6-5-4(1-2-8-6)9-3-10-5/h1-5H,(H2,7,8)(H,9,10) |
| InChIKey | KABBHOGXMMTQSA-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.16 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3a,7a-dihydro-1H-imidazo[4,5-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a,7a-dihydro-1H-imidazo[4,5-c]pyridin-4-amine?
The IUPAC name of 3a,7a-dihydro-1H-imidazo[4,5-c]pyridin-4-amine (CID 45120646) is 3a,7a-dihydro-1H-imidazo[4,5-c]pyridin-4-amine.
What is the SMILES notation for 3a,7a-dihydro-1H-imidazo[4,5-c]pyridin-4-amine?
The canonical SMILES for 3a,7a-dihydro-1H-imidazo[4,5-c]pyridin-4-amine is NC1=NC=CC2NC=NC12.
What is the InChIKey of 3a,7a-dihydro-1H-imidazo[4,5-c]pyridin-4-amine?
The InChIKey is KABBHOGXMMTQSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4/c7-6-5-4(1-2-8-6)9-3-10-5/h1-5H,(H2,7,8)(H,9,10).
What are the key properties of 3a,7a-dihydro-1H-imidazo[4,5-c]pyridin-4-amine?
3a,7a-dihydro-1H-imidazo[4,5-c]pyridin-4-amine has a molecular weight of 136.16 g/mol, XLogP of -0.76, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3a,7a-dihydro-1H-imidazo[4,5-c]pyridin-4-amine is sourced from PubChem (CID 45120646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).