About (2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)hydrazine
(2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)hydrazine (PubChem CID 45120675) has the molecular formula C7H9N5
and a molecular weight of 163.18 g/mol. Its IUPAC name is (2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)hydrazine.
Molecular Properties
| Compound Name | (2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)hydrazine |
| PubChem CID | 45120675 |
| Molecular Formula | C7H9N5 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.09 |
| IUPAC Name | (2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)hydrazine |
| SMILES | Cc1nc2ncc(NN)cc2[nH]1 |
| InChI | InChI=1S/C7H9N5/c1-4-10-6-2-5(12-8)3-9-7(6)11-4/h2-3,12H,8H2,1H3,(H,9,10,11) |
| InChIKey | VFYAJYIYWHVXFA-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)hydrazine?
The IUPAC name of (2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)hydrazine (CID 45120675) is (2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)hydrazine.
What is the SMILES notation for (2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)hydrazine?
The canonical SMILES for (2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)hydrazine is Cc1nc2ncc(NN)cc2[nH]1.
What is the InChIKey of (2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)hydrazine?
The InChIKey is VFYAJYIYWHVXFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5/c1-4-10-6-2-5(12-8)3-9-7(6)11-4/h2-3,12H,8H2,1H3,(H,9,10,11).
What are the key properties of (2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)hydrazine?
(2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)hydrazine has a molecular weight of 163.18 g/mol, XLogP of 0.55, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-1H-imidazo[4,5-b]pyridin-6-yl)hydrazine is sourced from PubChem (CID 45120675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).