About spiro[cyclopentane-1,2'-imidazo[4,5-b]pyridine]
spiro[cyclopentane-1,2'-imidazo[4,5-b]pyridine] (PubChem CID 45120767) has the molecular formula C10H11N3
and a molecular weight of 173.22 g/mol. Its IUPAC name is spiro[cyclopentane-1,2'-imidazo[4,5-b]pyridine].
Molecular Properties
| Compound Name | spiro[cyclopentane-1,2'-imidazo[4,5-b]pyridine] |
| PubChem CID | 45120767 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | spiro[cyclopentane-1,2'-imidazo[4,5-b]pyridine] |
| SMILES | c1cnc2c(c1)=NC1(CCCC1)N=2 |
| InChI | InChI=1S/C10H11N3/c1-2-6-10(5-1)12-8-4-3-7-11-9(8)13-10/h3-4,7H,1-2,5-6H2 |
| InChIKey | AVTSRLLPBOAZKE-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze spiro[cyclopentane-1,2'-imidazo[4,5-b]pyridine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[cyclopentane-1,2'-imidazo[4,5-b]pyridine]?
The IUPAC name of spiro[cyclopentane-1,2'-imidazo[4,5-b]pyridine] (CID 45120767) is spiro[cyclopentane-1,2'-imidazo[4,5-b]pyridine].
What is the SMILES notation for spiro[cyclopentane-1,2'-imidazo[4,5-b]pyridine]?
The canonical SMILES for spiro[cyclopentane-1,2'-imidazo[4,5-b]pyridine] is c1cnc2c(c1)=NC1(CCCC1)N=2.
What is the InChIKey of spiro[cyclopentane-1,2'-imidazo[4,5-b]pyridine]?
The InChIKey is AVTSRLLPBOAZKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3/c1-2-6-10(5-1)12-8-4-3-7-11-9(8)13-10/h3-4,7H,1-2,5-6H2.
What are the key properties of spiro[cyclopentane-1,2'-imidazo[4,5-b]pyridine]?
spiro[cyclopentane-1,2'-imidazo[4,5-b]pyridine] has a molecular weight of 173.22 g/mol, XLogP of 0.60, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[cyclopentane-1,2'-imidazo[4,5-b]pyridine] is sourced from PubChem (CID 45120767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).