About 3-(4,5-dihydro-1H-imidazol-2-yl)benzenethiol
3-(4,5-dihydro-1H-imidazol-2-yl)benzenethiol (PubChem CID 45120784) has the molecular formula C9H10N2S
and a molecular weight of 178.26 g/mol. Its IUPAC name is 3-(4,5-dihydro-1H-imidazol-2-yl)benzenethiol.
Molecular Properties
| Compound Name | 3-(4,5-dihydro-1H-imidazol-2-yl)benzenethiol |
| PubChem CID | 45120784 |
| Molecular Formula | C9H10N2S |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 3-(4,5-dihydro-1H-imidazol-2-yl)benzenethiol |
| SMILES | Sc1cccc(C2=NCCN2)c1 |
| InChI | InChI=1S/C9H10N2S/c12-8-3-1-2-7(6-8)9-10-4-5-11-9/h1-3,6,12H,4-5H2,(H,10,11) |
| InChIKey | LPLOQOOTZGQTML-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(4,5-dihydro-1H-imidazol-2-yl)benzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,5-dihydro-1H-imidazol-2-yl)benzenethiol?
The IUPAC name of 3-(4,5-dihydro-1H-imidazol-2-yl)benzenethiol (CID 45120784) is 3-(4,5-dihydro-1H-imidazol-2-yl)benzenethiol.
What is the SMILES notation for 3-(4,5-dihydro-1H-imidazol-2-yl)benzenethiol?
The canonical SMILES for 3-(4,5-dihydro-1H-imidazol-2-yl)benzenethiol is Sc1cccc(C2=NCCN2)c1.
What is the InChIKey of 3-(4,5-dihydro-1H-imidazol-2-yl)benzenethiol?
The InChIKey is LPLOQOOTZGQTML-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2S/c12-8-3-1-2-7(6-8)9-10-4-5-11-9/h1-3,6,12H,4-5H2,(H,10,11).
What are the key properties of 3-(4,5-dihydro-1H-imidazol-2-yl)benzenethiol?
3-(4,5-dihydro-1H-imidazol-2-yl)benzenethiol has a molecular weight of 178.26 g/mol, XLogP of 1.33, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,5-dihydro-1H-imidazol-2-yl)benzenethiol is sourced from PubChem (CID 45120784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).