About N-(2-aminoethyl)-2-(4,5-dihydro-1H-imidazol-2-yl)acetamide
N-(2-aminoethyl)-2-(4,5-dihydro-1H-imidazol-2-yl)acetamide (PubChem CID 45120810) has the molecular formula C7H14N4O
and a molecular weight of 170.22 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-(4,5-dihydro-1H-imidazol-2-yl)acetamide.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-2-(4,5-dihydro-1H-imidazol-2-yl)acetamide |
| PubChem CID | 45120810 |
| Molecular Formula | C7H14N4O |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | N-(2-aminoethyl)-2-(4,5-dihydro-1H-imidazol-2-yl)acetamide |
| SMILES | NCCNC(=O)CC1=NCCN1 |
| InChI | InChI=1S/C7H14N4O/c8-1-2-11-7(12)5-6-9-3-4-10-6/h1-5,8H2,(H,9,10)(H,11,12) |
| InChIKey | XEFSMGYCKVIBIN-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-aminoethyl)-2-(4,5-dihydro-1H-imidazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-2-(4,5-dihydro-1H-imidazol-2-yl)acetamide?
The IUPAC name of N-(2-aminoethyl)-2-(4,5-dihydro-1H-imidazol-2-yl)acetamide (CID 45120810) is N-(2-aminoethyl)-2-(4,5-dihydro-1H-imidazol-2-yl)acetamide.
What is the SMILES notation for N-(2-aminoethyl)-2-(4,5-dihydro-1H-imidazol-2-yl)acetamide?
The canonical SMILES for N-(2-aminoethyl)-2-(4,5-dihydro-1H-imidazol-2-yl)acetamide is NCCNC(=O)CC1=NCCN1.
What is the InChIKey of N-(2-aminoethyl)-2-(4,5-dihydro-1H-imidazol-2-yl)acetamide?
The InChIKey is XEFSMGYCKVIBIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4O/c8-1-2-11-7(12)5-6-9-3-4-10-6/h1-5,8H2,(H,9,10)(H,11,12).
What are the key properties of N-(2-aminoethyl)-2-(4,5-dihydro-1H-imidazol-2-yl)acetamide?
N-(2-aminoethyl)-2-(4,5-dihydro-1H-imidazol-2-yl)acetamide has a molecular weight of 170.22 g/mol, XLogP of -1.55, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-2-(4,5-dihydro-1H-imidazol-2-yl)acetamide is sourced from PubChem (CID 45120810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).