About 4-(1H-imidazol-5-yl)-2,2-dimethyl-1,3-dihydroimidazole;dihydrate
4-(1H-imidazol-5-yl)-2,2-dimethyl-1,3-dihydroimidazole;dihydrate (PubChem CID 45120951) has the molecular formula C8H16N4O2
and a molecular weight of 200.24 g/mol. Its IUPAC name is 4-(1H-imidazol-5-yl)-2,2-dimethyl-1,3-dihydroimidazole;dihydrate.
Molecular Properties
| Compound Name | 4-(1H-imidazol-5-yl)-2,2-dimethyl-1,3-dihydroimidazole;dihydrate |
| PubChem CID | 45120951 |
| Molecular Formula | C8H16N4O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 4-(1H-imidazol-5-yl)-2,2-dimethyl-1,3-dihydroimidazole;dihydrate |
| SMILES | CC1(C)NC=C(c2cnc[nH]2)N1.O.O |
| InChI | InChI=1S/C8H12N4.2H2O/c1-8(2)11-4-7(12-8)6-3-9-5-10-6;;/h3-5,11-12H,1-2H3,(H,9,10);2*1H2 |
| InChIKey | QTKMOFHGLQLTTJ-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 115.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1H-imidazol-5-yl)-2,2-dimethyl-1,3-dihydroimidazole;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1H-imidazol-5-yl)-2,2-dimethyl-1,3-dihydroimidazole;dihydrate?
The IUPAC name of 4-(1H-imidazol-5-yl)-2,2-dimethyl-1,3-dihydroimidazole;dihydrate (CID 45120951) is 4-(1H-imidazol-5-yl)-2,2-dimethyl-1,3-dihydroimidazole;dihydrate.
What is the SMILES notation for 4-(1H-imidazol-5-yl)-2,2-dimethyl-1,3-dihydroimidazole;dihydrate?
The canonical SMILES for 4-(1H-imidazol-5-yl)-2,2-dimethyl-1,3-dihydroimidazole;dihydrate is CC1(C)NC=C(c2cnc[nH]2)N1.O.O.
What is the InChIKey of 4-(1H-imidazol-5-yl)-2,2-dimethyl-1,3-dihydroimidazole;dihydrate?
The InChIKey is QTKMOFHGLQLTTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4.2H2O/c1-8(2)11-4-7(12-8)6-3-9-5-10-6;;/h3-5,11-12H,1-2H3,(H,9,10);2*1H2.
What are the key properties of 4-(1H-imidazol-5-yl)-2,2-dimethyl-1,3-dihydroimidazole;dihydrate?
4-(1H-imidazol-5-yl)-2,2-dimethyl-1,3-dihydroimidazole;dihydrate has a molecular weight of 200.24 g/mol, XLogP of -1.01, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1H-imidazol-5-yl)-2,2-dimethyl-1,3-dihydroimidazole;dihydrate is sourced from PubChem (CID 45120951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).