C15H10ClFN4O2 — CID 45121030
5-(2-aminopyrimidin-4-yl)-2-(4-chloro-2-fluorophenyl)-1H-pyrrole-3-carboxylic acid (PubChem CID 45121030) has the molecular formula C15H10ClFN4O2 and a molecular weight of 332.72 g/mol. Its IUPAC name is 5-(2-aminopyrimidin-4-yl)-2-(4-chloro-2-fluorophenyl)-1H-pyrrole-3-carboxylic acid.
| Compound Name | 5-(2-aminopyrimidin-4-yl)-2-(4-chloro-2-fluorophenyl)-1H-pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 45121030 |
| Molecular Formula | C15H10ClFN4O2 |
| Molecular Weight | 332.72 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 5-(2-aminopyrimidin-4-yl)-2-(4-chloro-2-fluorophenyl)-1H-pyrrole-3-carboxylic acid |
| SMILES | Nc1nccc(-c2cc(C(=O)O)c(-c3ccc(Cl)cc3F)[nH]2)n1 |
| InChI | InChI=1S/C15H10ClFN4O2/c16-7-1-2-8(10(17)5-7)13-9(14(22)23)6-12(20-13)11-3-4-19-15(18)21-11/h1-6,20H,(H,22,23)(H2,18,19,21) |
| InChIKey | JRHRWJBZZLKOIJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.72 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |