About 2,3-dihydro-1H-pyrazolo[1,2-a]pyridazine-5,8-dione
2,3-dihydro-1H-pyrazolo[1,2-a]pyridazine-5,8-dione (PubChem CID 45121280) has the molecular formula C7H8N2O2
and a molecular weight of 152.15 g/mol. Its IUPAC name is 2,3-dihydro-1H-pyrazolo[1,2-a]pyridazine-5,8-dione.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-pyrazolo[1,2-a]pyridazine-5,8-dione |
| PubChem CID | 45121280 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 2,3-dihydro-1H-pyrazolo[1,2-a]pyridazine-5,8-dione |
| SMILES | O=c1ccc(=O)n2n1CCC2 |
| InChI | InChI=1S/C7H8N2O2/c10-6-2-3-7(11)9-5-1-4-8(6)9/h2-3H,1,4-5H2 |
| InChIKey | HFHJOSGOGRYMIZ-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dihydro-1H-pyrazolo[1,2-a]pyridazine-5,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-pyrazolo[1,2-a]pyridazine-5,8-dione?
The IUPAC name of 2,3-dihydro-1H-pyrazolo[1,2-a]pyridazine-5,8-dione (CID 45121280) is 2,3-dihydro-1H-pyrazolo[1,2-a]pyridazine-5,8-dione.
What is the SMILES notation for 2,3-dihydro-1H-pyrazolo[1,2-a]pyridazine-5,8-dione?
The canonical SMILES for 2,3-dihydro-1H-pyrazolo[1,2-a]pyridazine-5,8-dione is O=c1ccc(=O)n2n1CCC2.
What is the InChIKey of 2,3-dihydro-1H-pyrazolo[1,2-a]pyridazine-5,8-dione?
The InChIKey is HFHJOSGOGRYMIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2/c10-6-2-3-7(11)9-5-1-4-8(6)9/h2-3H,1,4-5H2.
What are the key properties of 2,3-dihydro-1H-pyrazolo[1,2-a]pyridazine-5,8-dione?
2,3-dihydro-1H-pyrazolo[1,2-a]pyridazine-5,8-dione has a molecular weight of 152.15 g/mol, XLogP of -0.59, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-pyrazolo[1,2-a]pyridazine-5,8-dione is sourced from PubChem (CID 45121280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).