About 5-(ethoxymethyl)-1,3-dimethylpyrazole
5-(ethoxymethyl)-1,3-dimethylpyrazole (PubChem CID 45121372) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is 5-(ethoxymethyl)-1,3-dimethylpyrazole.
Molecular Properties
| Compound Name | 5-(ethoxymethyl)-1,3-dimethylpyrazole |
| PubChem CID | 45121372 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 5-(ethoxymethyl)-1,3-dimethylpyrazole |
| SMILES | CCOCc1cc(C)nn1C |
| InChI | InChI=1S/C8H14N2O/c1-4-11-6-8-5-7(2)9-10(8)3/h5H,4,6H2,1-3H3 |
| InChIKey | DLASMZRMNDSRDO-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(ethoxymethyl)-1,3-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(ethoxymethyl)-1,3-dimethylpyrazole?
The IUPAC name of 5-(ethoxymethyl)-1,3-dimethylpyrazole (CID 45121372) is 5-(ethoxymethyl)-1,3-dimethylpyrazole.
What is the SMILES notation for 5-(ethoxymethyl)-1,3-dimethylpyrazole?
The canonical SMILES for 5-(ethoxymethyl)-1,3-dimethylpyrazole is CCOCc1cc(C)nn1C.
What is the InChIKey of 5-(ethoxymethyl)-1,3-dimethylpyrazole?
The InChIKey is DLASMZRMNDSRDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O/c1-4-11-6-8-5-7(2)9-10(8)3/h5H,4,6H2,1-3H3.
What are the key properties of 5-(ethoxymethyl)-1,3-dimethylpyrazole?
5-(ethoxymethyl)-1,3-dimethylpyrazole has a molecular weight of 154.21 g/mol, XLogP of 1.27, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(ethoxymethyl)-1,3-dimethylpyrazole is sourced from PubChem (CID 45121372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).