C7H12N2O2 — CID 45121446
1,2,4,4-tetramethylpyrazolidine-3,5-dione (PubChem CID 45121446) has the molecular formula C7H12N2O2 and a molecular weight of 156.18 g/mol. Its IUPAC name is 1,2,4,4-tetramethylpyrazolidine-3,5-dione.
| Compound Name | 1,2,4,4-tetramethylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 45121446 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 1,2,4,4-tetramethylpyrazolidine-3,5-dione |
| SMILES | CN1C(=O)C(C)(C)C(=O)N1C |
| InChI | InChI=1S/C7H12N2O2/c1-7(2)5(10)8(3)9(4)6(7)11/h1-4H3 |
| InChIKey | RDQIUYJBFVIFIX-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|