About N-[(5-oxo-1,2-dihydropyrazol-3-yl)methyl]acetamide
N-[(5-oxo-1,2-dihydropyrazol-3-yl)methyl]acetamide (PubChem CID 45121471) has the molecular formula C6H9N3O2
and a molecular weight of 155.16 g/mol. Its IUPAC name is N-[(5-oxo-1,2-dihydropyrazol-3-yl)methyl]acetamide.
Molecular Properties
| Compound Name | N-[(5-oxo-1,2-dihydropyrazol-3-yl)methyl]acetamide |
| PubChem CID | 45121471 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | N-[(5-oxo-1,2-dihydropyrazol-3-yl)methyl]acetamide |
| SMILES | CC(=O)NCc1cc(=O)[nH][nH]1 |
| InChI | InChI=1S/C6H9N3O2/c1-4(10)7-3-5-2-6(11)9-8-5/h2H,3H2,1H3,(H,7,10)(H2,8,9,11) |
| InChIKey | VIEVHHUEDLVGAG-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(5-oxo-1,2-dihydropyrazol-3-yl)methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-oxo-1,2-dihydropyrazol-3-yl)methyl]acetamide?
The IUPAC name of N-[(5-oxo-1,2-dihydropyrazol-3-yl)methyl]acetamide (CID 45121471) is N-[(5-oxo-1,2-dihydropyrazol-3-yl)methyl]acetamide.
What is the SMILES notation for N-[(5-oxo-1,2-dihydropyrazol-3-yl)methyl]acetamide?
The canonical SMILES for N-[(5-oxo-1,2-dihydropyrazol-3-yl)methyl]acetamide is CC(=O)NCc1cc(=O)[nH][nH]1.
What is the InChIKey of N-[(5-oxo-1,2-dihydropyrazol-3-yl)methyl]acetamide?
The InChIKey is VIEVHHUEDLVGAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O2/c1-4(10)7-3-5-2-6(11)9-8-5/h2H,3H2,1H3,(H,7,10)(H2,8,9,11).
What are the key properties of N-[(5-oxo-1,2-dihydropyrazol-3-yl)methyl]acetamide?
N-[(5-oxo-1,2-dihydropyrazol-3-yl)methyl]acetamide has a molecular weight of 155.16 g/mol, XLogP of -0.66, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-oxo-1,2-dihydropyrazol-3-yl)methyl]acetamide is sourced from PubChem (CID 45121471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).