About 7H-pyrazolo[4,5-f]quinoxaline
7H-pyrazolo[4,5-f]quinoxaline (PubChem CID 45121540) has the molecular formula C9H6N4
and a molecular weight of 170.18 g/mol. Its IUPAC name is 7H-pyrazolo[4,5-f]quinoxaline.
Molecular Properties
| Compound Name | 7H-pyrazolo[4,5-f]quinoxaline |
| PubChem CID | 45121540 |
| Molecular Formula | C9H6N4 |
| Molecular Weight | 170.18 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 7H-pyrazolo[4,5-f]quinoxaline |
| SMILES | c1cnc2c(ccc3[nH]ncc32)n1 |
| InChI | InChI=1S/C9H6N4/c1-2-8-9(11-4-3-10-8)6-5-12-13-7(1)6/h1-5H,(H,12,13) |
| InChIKey | QWQLDUDGNBWKMM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.18 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7H-pyrazolo[4,5-f]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-pyrazolo[4,5-f]quinoxaline?
The IUPAC name of 7H-pyrazolo[4,5-f]quinoxaline (CID 45121540) is 7H-pyrazolo[4,5-f]quinoxaline.
What is the SMILES notation for 7H-pyrazolo[4,5-f]quinoxaline?
The canonical SMILES for 7H-pyrazolo[4,5-f]quinoxaline is c1cnc2c(ccc3[nH]ncc32)n1.
What is the InChIKey of 7H-pyrazolo[4,5-f]quinoxaline?
The InChIKey is QWQLDUDGNBWKMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N4/c1-2-8-9(11-4-3-10-8)6-5-12-13-7(1)6/h1-5H,(H,12,13).
What are the key properties of 7H-pyrazolo[4,5-f]quinoxaline?
7H-pyrazolo[4,5-f]quinoxaline has a molecular weight of 170.18 g/mol, XLogP of 1.51, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-pyrazolo[4,5-f]quinoxaline is sourced from PubChem (CID 45121540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).