About [1,2]oxazolo[4,3-f]quinoxaline
[1,2]oxazolo[4,3-f]quinoxaline (PubChem CID 45121585) has the molecular formula C9H5N3O
and a molecular weight of 171.16 g/mol. Its IUPAC name is [1,2]oxazolo[4,3-f]quinoxaline.
Molecular Properties
| Compound Name | [1,2]oxazolo[4,3-f]quinoxaline |
| PubChem CID | 45121585 |
| Molecular Formula | C9H5N3O |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.04 |
| IUPAC Name | [1,2]oxazolo[4,3-f]quinoxaline |
| SMILES | c1cnc2c(ccc3nocc32)n1 |
| InChI | InChI=1S/C9H5N3O/c1-2-8-9(11-4-3-10-8)6-5-13-12-7(1)6/h1-5H |
| InChIKey | JWYUEPRVYWDZEQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1,2]oxazolo[4,3-f]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,2]oxazolo[4,3-f]quinoxaline?
The IUPAC name of [1,2]oxazolo[4,3-f]quinoxaline (CID 45121585) is [1,2]oxazolo[4,3-f]quinoxaline.
What is the SMILES notation for [1,2]oxazolo[4,3-f]quinoxaline?
The canonical SMILES for [1,2]oxazolo[4,3-f]quinoxaline is c1cnc2c(ccc3nocc32)n1.
What is the InChIKey of [1,2]oxazolo[4,3-f]quinoxaline?
The InChIKey is JWYUEPRVYWDZEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5N3O/c1-2-8-9(11-4-3-10-8)6-5-13-12-7(1)6/h1-5H.
What are the key properties of [1,2]oxazolo[4,3-f]quinoxaline?
[1,2]oxazolo[4,3-f]quinoxaline has a molecular weight of 171.16 g/mol, XLogP of 1.77, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1,2]oxazolo[4,3-f]quinoxaline is sourced from PubChem (CID 45121585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).