About [2-(hydroxymethyl)-1,3-thiazol-4-yl]boronic acid
[2-(hydroxymethyl)-1,3-thiazol-4-yl]boronic acid (PubChem CID 45121637) has the molecular formula C4H6BNO3S
and a molecular weight of 158.97 g/mol. Its IUPAC name is [2-(hydroxymethyl)-1,3-thiazol-4-yl]boronic acid.
Molecular Properties
| Compound Name | [2-(hydroxymethyl)-1,3-thiazol-4-yl]boronic acid |
| PubChem CID | 45121637 |
| Molecular Formula | C4H6BNO3S |
| Molecular Weight | 158.97 g/mol |
| Exact Mass | 159.02 |
| IUPAC Name | [2-(hydroxymethyl)-1,3-thiazol-4-yl]boronic acid |
| SMILES | OCc1nc(B(O)O)cs1 |
| InChI | InChI=1S/C4H6BNO3S/c7-1-4-6-3(2-10-4)5(8)9/h2,7-9H,1H2 |
| InChIKey | MLXZHKDAUSPXJG-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.97 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2-(hydroxymethyl)-1,3-thiazol-4-yl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(hydroxymethyl)-1,3-thiazol-4-yl]boronic acid?
The IUPAC name of [2-(hydroxymethyl)-1,3-thiazol-4-yl]boronic acid (CID 45121637) is [2-(hydroxymethyl)-1,3-thiazol-4-yl]boronic acid.
What is the SMILES notation for [2-(hydroxymethyl)-1,3-thiazol-4-yl]boronic acid?
The canonical SMILES for [2-(hydroxymethyl)-1,3-thiazol-4-yl]boronic acid is OCc1nc(B(O)O)cs1.
What is the InChIKey of [2-(hydroxymethyl)-1,3-thiazol-4-yl]boronic acid?
The InChIKey is MLXZHKDAUSPXJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6BNO3S/c7-1-4-6-3(2-10-4)5(8)9/h2,7-9H,1H2.
What are the key properties of [2-(hydroxymethyl)-1,3-thiazol-4-yl]boronic acid?
[2-(hydroxymethyl)-1,3-thiazol-4-yl]boronic acid has a molecular weight of 158.97 g/mol, XLogP of -1.68, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(hydroxymethyl)-1,3-thiazol-4-yl]boronic acid is sourced from PubChem (CID 45121637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).