About [1,3]thiazolo[5,4-d]pyrimidin-2-amine
[1,3]thiazolo[5,4-d]pyrimidin-2-amine (PubChem CID 45121748) has the molecular formula C5H4N4S
and a molecular weight of 152.18 g/mol. Its IUPAC name is [1,3]thiazolo[5,4-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | [1,3]thiazolo[5,4-d]pyrimidin-2-amine |
| PubChem CID | 45121748 |
| Molecular Formula | C5H4N4S |
| Molecular Weight | 152.18 g/mol |
| Exact Mass | 152.02 |
| IUPAC Name | [1,3]thiazolo[5,4-d]pyrimidin-2-amine |
| SMILES | Nc1nc2cncnc2s1 |
| InChI | InChI=1S/C5H4N4S/c6-5-9-3-1-7-2-8-4(3)10-5/h1-2H,(H2,6,9) |
| InChIKey | YGKQRZSYDSDMHE-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.18 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1,3]thiazolo[5,4-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3]thiazolo[5,4-d]pyrimidin-2-amine?
The IUPAC name of [1,3]thiazolo[5,4-d]pyrimidin-2-amine (CID 45121748) is [1,3]thiazolo[5,4-d]pyrimidin-2-amine.
What is the SMILES notation for [1,3]thiazolo[5,4-d]pyrimidin-2-amine?
The canonical SMILES for [1,3]thiazolo[5,4-d]pyrimidin-2-amine is Nc1nc2cncnc2s1.
What is the InChIKey of [1,3]thiazolo[5,4-d]pyrimidin-2-amine?
The InChIKey is YGKQRZSYDSDMHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4S/c6-5-9-3-1-7-2-8-4(3)10-5/h1-2H,(H2,6,9).
What are the key properties of [1,3]thiazolo[5,4-d]pyrimidin-2-amine?
[1,3]thiazolo[5,4-d]pyrimidin-2-amine has a molecular weight of 152.18 g/mol, XLogP of 0.67, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3]thiazolo[5,4-d]pyrimidin-2-amine is sourced from PubChem (CID 45121748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).