About 5-ethynyl-1,3-thiazole-2-carboxamide
5-ethynyl-1,3-thiazole-2-carboxamide (PubChem CID 45121753) has the molecular formula C6H4N2OS
and a molecular weight of 152.18 g/mol. Its IUPAC name is 5-ethynyl-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | 5-ethynyl-1,3-thiazole-2-carboxamide |
| PubChem CID | 45121753 |
| Molecular Formula | C6H4N2OS |
| Molecular Weight | 152.18 g/mol |
| Exact Mass | 152.00 |
| IUPAC Name | 5-ethynyl-1,3-thiazole-2-carboxamide |
| SMILES | C#Cc1cnc(C(N)=O)s1 |
| InChI | InChI=1S/C6H4N2OS/c1-2-4-3-8-6(10-4)5(7)9/h1,3H,(H2,7,9) |
| InChIKey | GRBOEWSEOQHCOJ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.18 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-ethynyl-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethynyl-1,3-thiazole-2-carboxamide?
The IUPAC name of 5-ethynyl-1,3-thiazole-2-carboxamide (CID 45121753) is 5-ethynyl-1,3-thiazole-2-carboxamide.
What is the SMILES notation for 5-ethynyl-1,3-thiazole-2-carboxamide?
The canonical SMILES for 5-ethynyl-1,3-thiazole-2-carboxamide is C#Cc1cnc(C(N)=O)s1.
What is the InChIKey of 5-ethynyl-1,3-thiazole-2-carboxamide?
The InChIKey is GRBOEWSEOQHCOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2OS/c1-2-4-3-8-6(10-4)5(7)9/h1,3H,(H2,7,9).
What are the key properties of 5-ethynyl-1,3-thiazole-2-carboxamide?
5-ethynyl-1,3-thiazole-2-carboxamide has a molecular weight of 152.18 g/mol, XLogP of 0.22, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethynyl-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 45121753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).