About 2-ethyl-4,5-dimethyl-3-oxido-1,3-thiazol-3-ium
2-ethyl-4,5-dimethyl-3-oxido-1,3-thiazol-3-ium (PubChem CID 45121760) has the molecular formula C7H11NOS
and a molecular weight of 157.24 g/mol. Its IUPAC name is 2-ethyl-4,5-dimethyl-3-oxido-1,3-thiazol-3-ium.
Molecular Properties
| Compound Name | 2-ethyl-4,5-dimethyl-3-oxido-1,3-thiazol-3-ium |
| PubChem CID | 45121760 |
| Molecular Formula | C7H11NOS |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | 2-ethyl-4,5-dimethyl-3-oxido-1,3-thiazol-3-ium |
| SMILES | CCc1sc(C)c(C)[n+]1[O-] |
| InChI | InChI=1S/C7H11NOS/c1-4-7-8(9)5(2)6(3)10-7/h4H2,1-3H3 |
| InChIKey | QKHWCFWELWHJHU-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 26.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-4,5-dimethyl-3-oxido-1,3-thiazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4,5-dimethyl-3-oxido-1,3-thiazol-3-ium?
The IUPAC name of 2-ethyl-4,5-dimethyl-3-oxido-1,3-thiazol-3-ium (CID 45121760) is 2-ethyl-4,5-dimethyl-3-oxido-1,3-thiazol-3-ium.
What is the SMILES notation for 2-ethyl-4,5-dimethyl-3-oxido-1,3-thiazol-3-ium?
The canonical SMILES for 2-ethyl-4,5-dimethyl-3-oxido-1,3-thiazol-3-ium is CCc1sc(C)c(C)[n+]1[O-].
What is the InChIKey of 2-ethyl-4,5-dimethyl-3-oxido-1,3-thiazol-3-ium?
The InChIKey is QKHWCFWELWHJHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NOS/c1-4-7-8(9)5(2)6(3)10-7/h4H2,1-3H3.
What are the key properties of 2-ethyl-4,5-dimethyl-3-oxido-1,3-thiazol-3-ium?
2-ethyl-4,5-dimethyl-3-oxido-1,3-thiazol-3-ium has a molecular weight of 157.24 g/mol, XLogP of 1.56, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4,5-dimethyl-3-oxido-1,3-thiazol-3-ium is sourced from PubChem (CID 45121760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).