C7H10N2S — CID 45121902
4,5,6,7-tetrahydro-1,3-benzothiazol-6-amine (PubChem CID 45121902) has the molecular formula C7H10N2S and a molecular weight of 154.24 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-1,3-benzothiazol-6-amine.
| Compound Name | 4,5,6,7-tetrahydro-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 45121902 |
| Molecular Formula | C7H10N2S |
| Molecular Weight | 154.24 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 4,5,6,7-tetrahydro-1,3-benzothiazol-6-amine |
| SMILES | NC1CCc2ncsc2C1 |
| InChI | InChI=1S/C7H10N2S/c8-5-1-2-6-7(3-5)10-4-9-6/h4-5H,1-3,8H2 |
| InChIKey | MLHMXNRCJFPJOB-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.24 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |