3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid

C8H11NO5S — CID 45122366

IUPAC3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid
SMILESCC(=O)N1C(C(=O)O)CSC1(C)C(=O)O
InChIInChI=1S/C8H11NO5S/c1-4(10)9-5(6(11)12)3-15-8(9,2)7(13)14/h5H,3H2,1-2H3,(H,11,12)(H,13,14)
InChIKeyCMLMTPHQDNAMKO-UHFFFAOYSA-N
MW233.24 g/mol
LogP-0.16
Rot. Bonds2

About 3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid

3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid (PubChem CID 45122366) has the molecular formula C8H11NO5S and a molecular weight of 233.24 g/mol. Its IUPAC name is 3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid.

Molecular Properties

Compound Name3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid
PubChem CID45122366
Molecular FormulaC8H11NO5S
Molecular Weight233.24 g/mol
Exact Mass233.04
IUPAC Name3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid
SMILESCC(=O)N1C(C(=O)O)CSC1(C)C(=O)O
InChIInChI=1S/C8H11NO5S/c1-4(10)9-5(6(11)12)3-15-8(9,2)7(13)14/h5H,3H2,1-2H3,(H,11,12)(H,13,14)
InChIKeyCMLMTPHQDNAMKO-UHFFFAOYSA-N
XLogP-0.16
TPSA94.91 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.24
LogP ≤ 5-0.16
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid?
The IUPAC name of 3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid (CID 45122366) is 3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid.
What is the SMILES notation for 3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid?
The canonical SMILES for 3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid is CC(=O)N1C(C(=O)O)CSC1(C)C(=O)O.
What is the InChIKey of 3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid?
The InChIKey is CMLMTPHQDNAMKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO5S/c1-4(10)9-5(6(11)12)3-15-8(9,2)7(13)14/h5H,3H2,1-2H3,(H,11,12)(H,13,14).
What are the key properties of 3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid?
3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid has a molecular weight of 233.24 g/mol, XLogP of -0.16, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid is sourced from PubChem (CID 45122366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).