About 3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid
3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid (PubChem CID 45122366) has the molecular formula C8H11NO5S
and a molecular weight of 233.24 g/mol. Its IUPAC name is 3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid.
Molecular Properties
| Compound Name | 3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid |
| PubChem CID | 45122366 |
| Molecular Formula | C8H11NO5S |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid |
| SMILES | CC(=O)N1C(C(=O)O)CSC1(C)C(=O)O |
| InChI | InChI=1S/C8H11NO5S/c1-4(10)9-5(6(11)12)3-15-8(9,2)7(13)14/h5H,3H2,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | CMLMTPHQDNAMKO-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid?
The IUPAC name of 3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid (CID 45122366) is 3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid.
What is the SMILES notation for 3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid?
The canonical SMILES for 3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid is CC(=O)N1C(C(=O)O)CSC1(C)C(=O)O.
What is the InChIKey of 3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid?
The InChIKey is CMLMTPHQDNAMKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO5S/c1-4(10)9-5(6(11)12)3-15-8(9,2)7(13)14/h5H,3H2,1-2H3,(H,11,12)(H,13,14).
What are the key properties of 3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid?
3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid has a molecular weight of 233.24 g/mol, XLogP of -0.16, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-2-methyl-1,3-thiazolidine-2,4-dicarboxylic acid is sourced from PubChem (CID 45122366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).