About 7H-furo[2,3-f]indole
7H-furo[2,3-f]indole (PubChem CID 45122558) has the molecular formula C10H7NO
and a molecular weight of 157.17 g/mol. Its IUPAC name is 7H-furo[2,3-f]indole.
Molecular Properties
| Compound Name | 7H-furo[2,3-f]indole |
| PubChem CID | 45122558 |
| Molecular Formula | C10H7NO |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.05 |
| IUPAC Name | 7H-furo[2,3-f]indole |
| SMILES | C1=Nc2cc3ccoc3cc2C1 |
| InChI | InChI=1S/C10H7NO/c1-3-11-9-5-8-2-4-12-10(8)6-7(1)9/h2-6H,1H2 |
| InChIKey | HYNMBMPMHWWUDT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 25.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7H-furo[2,3-f]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-furo[2,3-f]indole?
The IUPAC name of 7H-furo[2,3-f]indole (CID 45122558) is 7H-furo[2,3-f]indole.
What is the SMILES notation for 7H-furo[2,3-f]indole?
The canonical SMILES for 7H-furo[2,3-f]indole is C1=Nc2cc3ccoc3cc2C1.
What is the InChIKey of 7H-furo[2,3-f]indole?
The InChIKey is HYNMBMPMHWWUDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO/c1-3-11-9-5-8-2-4-12-10(8)6-7(1)9/h2-6H,1H2.
What are the key properties of 7H-furo[2,3-f]indole?
7H-furo[2,3-f]indole has a molecular weight of 157.17 g/mol, XLogP of 2.69, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-furo[2,3-f]indole is sourced from PubChem (CID 45122558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).