About 6H-furo[3,2-f]isoindole
6H-furo[3,2-f]isoindole (PubChem CID 45122577) has the molecular formula C10H7NO
and a molecular weight of 157.17 g/mol. Its IUPAC name is 6H-furo[3,2-f]isoindole.
Molecular Properties
| Compound Name | 6H-furo[3,2-f]isoindole |
| PubChem CID | 45122577 |
| Molecular Formula | C10H7NO |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.05 |
| IUPAC Name | 6H-furo[3,2-f]isoindole |
| SMILES | c1cc2cc3c[nH]cc3cc2o1 |
| InChI | InChI=1S/C10H7NO/c1-2-12-10-4-9-6-11-5-8(9)3-7(1)10/h1-6,11H |
| InChIKey | PSEBTXFRSGUBFH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6H-furo[3,2-f]isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-furo[3,2-f]isoindole?
The IUPAC name of 6H-furo[3,2-f]isoindole (CID 45122577) is 6H-furo[3,2-f]isoindole.
What is the SMILES notation for 6H-furo[3,2-f]isoindole?
The canonical SMILES for 6H-furo[3,2-f]isoindole is c1cc2cc3c[nH]cc3cc2o1.
What is the InChIKey of 6H-furo[3,2-f]isoindole?
The InChIKey is PSEBTXFRSGUBFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO/c1-2-12-10-4-9-6-11-5-8(9)3-7(1)10/h1-6,11H.
What are the key properties of 6H-furo[3,2-f]isoindole?
6H-furo[3,2-f]isoindole has a molecular weight of 157.17 g/mol, XLogP of 2.91, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-furo[3,2-f]isoindole is sourced from PubChem (CID 45122577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).