C8H13NO2 — CID 45122826
3,4,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-2-one (PubChem CID 45122826) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-2-one.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-2-one |
|---|---|
| PubChem CID | 45122826 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-2-one |
| SMILES | O=C1CNC2CCCCC2O1 |
| InChI | InChI=1S/C8H13NO2/c10-8-5-9-6-3-1-2-4-7(6)11-8/h6-7,9H,1-5H2 |
| InChIKey | RSUIWLHVBMPSKB-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |