About N-(4-cyano-3-methyl-1,2-oxazol-5-yl)propanamide
N-(4-cyano-3-methyl-1,2-oxazol-5-yl)propanamide (PubChem CID 45122943) has the molecular formula C8H9N3O2
and a molecular weight of 179.18 g/mol. Its IUPAC name is N-(4-cyano-3-methyl-1,2-oxazol-5-yl)propanamide.
Molecular Properties
| Compound Name | N-(4-cyano-3-methyl-1,2-oxazol-5-yl)propanamide |
| PubChem CID | 45122943 |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | N-(4-cyano-3-methyl-1,2-oxazol-5-yl)propanamide |
| SMILES | CCC(=O)Nc1onc(C)c1C#N |
| InChI | InChI=1S/C8H9N3O2/c1-3-7(12)10-8-6(4-9)5(2)11-13-8/h3H2,1-2H3,(H,10,12) |
| InChIKey | HYLFIGVZZSFHKP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-cyano-3-methyl-1,2-oxazol-5-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-cyano-3-methyl-1,2-oxazol-5-yl)propanamide?
The IUPAC name of N-(4-cyano-3-methyl-1,2-oxazol-5-yl)propanamide (CID 45122943) is N-(4-cyano-3-methyl-1,2-oxazol-5-yl)propanamide.
What is the SMILES notation for N-(4-cyano-3-methyl-1,2-oxazol-5-yl)propanamide?
The canonical SMILES for N-(4-cyano-3-methyl-1,2-oxazol-5-yl)propanamide is CCC(=O)Nc1onc(C)c1C#N.
What is the InChIKey of N-(4-cyano-3-methyl-1,2-oxazol-5-yl)propanamide?
The InChIKey is HYLFIGVZZSFHKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O2/c1-3-7(12)10-8-6(4-9)5(2)11-13-8/h3H2,1-2H3,(H,10,12).
What are the key properties of N-(4-cyano-3-methyl-1,2-oxazol-5-yl)propanamide?
N-(4-cyano-3-methyl-1,2-oxazol-5-yl)propanamide has a molecular weight of 179.18 g/mol, XLogP of 1.20, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-cyano-3-methyl-1,2-oxazol-5-yl)propanamide is sourced from PubChem (CID 45122943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).