About N-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)propanamide
N-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)propanamide (PubChem CID 45122976) has the molecular formula C5H7N3O2S
and a molecular weight of 173.20 g/mol. Its IUPAC name is N-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)propanamide.
Molecular Properties
| Compound Name | N-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)propanamide |
| PubChem CID | 45122976 |
| Molecular Formula | C5H7N3O2S |
| Molecular Weight | 173.20 g/mol |
| Exact Mass | 173.03 |
| IUPAC Name | N-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)propanamide |
| SMILES | CCC(=O)Nc1n[nH]c(=S)o1 |
| InChI | InChI=1S/C5H7N3O2S/c1-2-3(9)6-4-7-8-5(11)10-4/h2H2,1H3,(H,8,11)(H,6,7,9) |
| InChIKey | APOWRZXXBWYFGX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.20 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)propanamide?
The IUPAC name of N-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)propanamide (CID 45122976) is N-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)propanamide.
What is the SMILES notation for N-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)propanamide?
The canonical SMILES for N-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)propanamide is CCC(=O)Nc1n[nH]c(=S)o1.
What is the InChIKey of N-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)propanamide?
The InChIKey is APOWRZXXBWYFGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O2S/c1-2-3(9)6-4-7-8-5(11)10-4/h2H2,1H3,(H,8,11)(H,6,7,9).
What are the key properties of N-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)propanamide?
N-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)propanamide has a molecular weight of 173.20 g/mol, XLogP of 1.08, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)propanamide is sourced from PubChem (CID 45122976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).