C27H25FN2O8S — CID 45123634
acetic acid;methyl 2-[(3E)-2-(4-fluorophenyl)-3-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 45123634) has the molecular formula C27H25FN2O8S and a molecular weight of 556.57 g/mol. Its IUPAC name is acetic acid;methyl 2-[(3E)-2-(4-fluorophenyl)-3-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | acetic acid;methyl 2-[(3E)-2-(4-fluorophenyl)-3-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 45123634 |
| Molecular Formula | C27H25FN2O8S |
| Molecular Weight | 556.57 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | acetic acid;methyl 2-[(3E)-2-(4-fluorophenyl)-3-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CC(=O)O.COC(=O)c1sc(N2C(=O)C(=O)/C(=C(/O)c3ccc(OC)c(C)c3)C2c2ccc(F)cc2)nc1C |
| InChI | InChI=1S/C25H21FN2O6S.C2H4O2/c1-12-11-15(7-10-17(12)33-3)20(29)18-19(14-5-8-16(26)9-6-14)28(23(31)21(18)30)25-27-13(2)22(35-25)24(32)34-4;1-2(3)4/h5-11,19,29H,1-4H3;1H3,(H,3,4)/b20-18+; |
| InChIKey | VCKCZNMHSPGMSS-KPJFUTMLSA-N |
| XLogP | 4.41 |
| TPSA | 143.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.57 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|