C30H21N3O2 — CID 45124453
17-(4-phenyldiazenylphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 45124453) has the molecular formula C30H21N3O2 and a molecular weight of 455.52 g/mol. Its IUPAC name is 17-(4-phenyldiazenylphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | 17-(4-phenyldiazenylphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 45124453 |
| Molecular Formula | C30H21N3O2 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 17-(4-phenyldiazenylphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | O=C1C2C3c4ccccc4C(c4ccccc43)C2C(=O)N1c1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C30H21N3O2/c34-29-27-25-21-10-4-5-11-22(21)26(24-13-7-6-12-23(24)25)28(27)30(35)33(29)20-16-14-19(15-17-20)32-31-18-8-2-1-3-9-18/h1-17,25-28H/b32-31+ |
| InChIKey | DUJQGCYSRMFPCY-QNEJGDQOSA-N |
| XLogP | 6.50 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|