C25H21N3O7 — CID 45125274
(4E)-4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-5-(4-nitrophenyl)-1-(pyridin-4-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 45125274) has the molecular formula C25H21N3O7 and a molecular weight of 475.46 g/mol. Its IUPAC name is (4E)-4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-5-(4-nitrophenyl)-1-(pyridin-4-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-5-(4-nitrophenyl)-1-(pyridin-4-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 45125274 |
| Molecular Formula | C25H21N3O7 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | (4E)-4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-5-(4-nitrophenyl)-1-(pyridin-4-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(/C(O)=C2\C(=O)C(=O)N(Cc3ccncc3)C2c2ccc([N+](=O)[O-])cc2)cc1OC |
| InChI | InChI=1S/C25H21N3O7/c1-34-19-8-5-17(13-20(19)35-2)23(29)21-22(16-3-6-18(7-4-16)28(32)33)27(25(31)24(21)30)14-15-9-11-26-12-10-15/h3-13,22,29H,14H2,1-2H3/b23-21+ |
| InChIKey | BHSZOEBHPZQVSN-XTQSDGFTSA-N |
| XLogP | 3.63 |
| TPSA | 132.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|