C20H23BrN2S — CID 45125483
3-ethyl-4-phenyl-N-(2,4,6-trimethylphenyl)-1,3-thiazol-3-ium-2-amine bromide (PubChem CID 45125483) has the molecular formula C20H23BrN2S and a molecular weight of 403.39 g/mol. Its IUPAC name is 3-ethyl-4-phenyl-N-(2,4,6-trimethylphenyl)-1,3-thiazol-3-ium-2-amine bromide.
| Compound Name | 3-ethyl-4-phenyl-N-(2,4,6-trimethylphenyl)-1,3-thiazol-3-ium-2-amine bromide |
|---|---|
| PubChem CID | 45125483 |
| Molecular Formula | C20H23BrN2S |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 3-ethyl-4-phenyl-N-(2,4,6-trimethylphenyl)-1,3-thiazol-3-ium-2-amine bromide |
| SMILES | CC[n+]1c(-c2ccccc2)csc1Nc1c(C)cc(C)cc1C.[Br-] |
| InChI | InChI=1S/C20H22N2S.BrH/c1-5-22-18(17-9-7-6-8-10-17)13-23-20(22)21-19-15(3)11-14(2)12-16(19)4;/h6-13H,5H2,1-4H3;1H |
| InChIKey | BFALPOQSFOVGFV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiaz_ene_D(8)', 'substructure': 'N/A'}, {'alert_name': 'thiazole_amine_D(3)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|