About (1S)-1-[5-[(1S)-1-hydroxyethyl]-4-[(E)-3-methylbutan-2-ylideneamino]-1,2,4-triazol-3-yl]ethanol
(1S)-1-[5-[(1S)-1-hydroxyethyl]-4-[(E)-3-methylbutan-2-ylideneamino]-1,2,4-triazol-3-yl]ethanol (PubChem CID 45125722) has the molecular formula C11H20N4O2
and a molecular weight of 240.31 g/mol. Its IUPAC name is (1S)-1-[5-[(1S)-1-hydroxyethyl]-4-[(E)-3-methylbutan-2-ylideneamino]-1,2,4-triazol-3-yl]ethanol.
Molecular Properties
| Compound Name | (1S)-1-[5-[(1S)-1-hydroxyethyl]-4-[(E)-3-methylbutan-2-ylideneamino]-1,2,4-triazol-3-yl]ethanol |
| PubChem CID | 45125722 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | (1S)-1-[5-[(1S)-1-hydroxyethyl]-4-[(E)-3-methylbutan-2-ylideneamino]-1,2,4-triazol-3-yl]ethanol |
| SMILES | C/C(=N\n1c([C@H](C)O)nnc1[C@H](C)O)C(C)C |
| InChI | InChI=1S/C11H20N4O2/c1-6(2)7(3)14-15-10(8(4)16)12-13-11(15)9(5)17/h6,8-9,16-17H,1-5H3/b14-7+/t8-,9-/m0/s1 |
| InChIKey | FIHXCWJZPAKYAN-CFQUMVPPSA-N |
| XLogP | 1.26 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-[5-[(1S)-1-hydroxyethyl]-4-[(E)-3-methylbutan-2-ylideneamino]-1,2,4-triazol-3-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[5-[(1S)-1-hydroxyethyl]-4-[(E)-3-methylbutan-2-ylideneamino]-1,2,4-triazol-3-yl]ethanol?
The IUPAC name of (1S)-1-[5-[(1S)-1-hydroxyethyl]-4-[(E)-3-methylbutan-2-ylideneamino]-1,2,4-triazol-3-yl]ethanol (CID 45125722) is (1S)-1-[5-[(1S)-1-hydroxyethyl]-4-[(E)-3-methylbutan-2-ylideneamino]-1,2,4-triazol-3-yl]ethanol.
What is the SMILES notation for (1S)-1-[5-[(1S)-1-hydroxyethyl]-4-[(E)-3-methylbutan-2-ylideneamino]-1,2,4-triazol-3-yl]ethanol?
The canonical SMILES for (1S)-1-[5-[(1S)-1-hydroxyethyl]-4-[(E)-3-methylbutan-2-ylideneamino]-1,2,4-triazol-3-yl]ethanol is C/C(=N\n1c([C@H](C)O)nnc1[C@H](C)O)C(C)C.
What is the InChIKey of (1S)-1-[5-[(1S)-1-hydroxyethyl]-4-[(E)-3-methylbutan-2-ylideneamino]-1,2,4-triazol-3-yl]ethanol?
The InChIKey is FIHXCWJZPAKYAN-CFQUMVPPSA-N. The full InChI is InChI=1S/C11H20N4O2/c1-6(2)7(3)14-15-10(8(4)16)12-13-11(15)9(5)17/h6,8-9,16-17H,1-5H3/b14-7+/t8-,9-/m0/s1.
What are the key properties of (1S)-1-[5-[(1S)-1-hydroxyethyl]-4-[(E)-3-methylbutan-2-ylideneamino]-1,2,4-triazol-3-yl]ethanol?
(1S)-1-[5-[(1S)-1-hydroxyethyl]-4-[(E)-3-methylbutan-2-ylideneamino]-1,2,4-triazol-3-yl]ethanol has a molecular weight of 240.31 g/mol, XLogP of 1.26, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[5-[(1S)-1-hydroxyethyl]-4-[(E)-3-methylbutan-2-ylideneamino]-1,2,4-triazol-3-yl]ethanol is sourced from PubChem (CID 45125722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).