C10H15ClN6O2 — CID 45126429
3-[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-5-chloro-1,3-oxazolidin-2-one (PubChem CID 45126429) has the molecular formula C10H15ClN6O2 and a molecular weight of 286.72 g/mol. Its IUPAC name is 3-[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-5-chloro-1,3-oxazolidin-2-one.
| Compound Name | 3-[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-5-chloro-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 45126429 |
| Molecular Formula | C10H15ClN6O2 |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 3-[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-5-chloro-1,3-oxazolidin-2-one |
| SMILES | CN(C)c1nc(N(C)C)nc(N2CC(Cl)OC2=O)n1 |
| InChI | InChI=1S/C10H15ClN6O2/c1-15(2)7-12-8(16(3)4)14-9(13-7)17-5-6(11)19-10(17)18/h6H,5H2,1-4H3 |
| InChIKey | OQZDFMDUFALHJX-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 74.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'melamine_B(1)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|