C30H25FN2O7S — CID 45128677
acetic acid;(4E)-5-(2-fluorophenyl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 45128677) has the molecular formula C30H25FN2O7S and a molecular weight of 576.60 g/mol. Its IUPAC name is acetic acid;(4E)-5-(2-fluorophenyl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | acetic acid;(4E)-5-(2-fluorophenyl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 45128677 |
| Molecular Formula | C30H25FN2O7S |
| Molecular Weight | 576.60 g/mol |
| Exact Mass | 576.14 |
| IUPAC Name | acetic acid;(4E)-5-(2-fluorophenyl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | CC(=O)O.COc1ccc2nc(N3C(=O)C(=O)/C(=C(/O)c4ccc5c(c4)CC(C)O5)C3c3ccccc3F)sc2c1 |
| InChI | InChI=1S/C28H21FN2O5S.C2H4O2/c1-14-11-16-12-15(7-10-21(16)36-14)25(32)23-24(18-5-3-4-6-19(18)29)31(27(34)26(23)33)28-30-20-9-8-17(35-2)13-22(20)37-28;1-2(3)4/h3-10,12-14,24,32H,11H2,1-2H3;1H3,(H,3,4)/b25-23+; |
| InChIKey | KFDPYLCLXQCCNQ-PHEASTCWSA-N |
| XLogP | 5.48 |
| TPSA | 126.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.60 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|