About [(Z)-1-(2,2-dimethylpropanoylamino)-2-(4-methylanilino)ethenyl]-triphenylphosphanium chloride
[(Z)-1-(2,2-dimethylpropanoylamino)-2-(4-methylanilino)ethenyl]-triphenylphosphanium chloride (PubChem CID 45129069) has the molecular formula C32H34ClN2OP
and a molecular weight of 529.06 g/mol. Its IUPAC name is [(Z)-1-(2,2-dimethylpropanoylamino)-2-(4-methylanilino)ethenyl]-triphenylphosphanium chloride.
Molecular Properties
| Compound Name | [(Z)-1-(2,2-dimethylpropanoylamino)-2-(4-methylanilino)ethenyl]-triphenylphosphanium chloride |
| PubChem CID | 45129069 |
| Molecular Formula | C32H34ClN2OP |
| Molecular Weight | 529.06 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | [(Z)-1-(2,2-dimethylpropanoylamino)-2-(4-methylanilino)ethenyl]-triphenylphosphanium chloride |
| SMILES | Cc1ccc(N/C=C(/NC(=O)C(C)(C)C)[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.[Cl-] |
| InChI | InChI=1S/C32H33N2OP.ClH/c1-25-20-22-26(23-21-25)33-24-30(34-31(35)32(2,3)4)36(27-14-8-5-9-15-27,28-16-10-6-11-17-28)29-18-12-7-13-19-29;/h5-24,33H,1-4H3;1H/b30-24-; |
| InChIKey | CLPWHBMINCHMLS-BXMGYBSLSA-N |
| XLogP | 3.37 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 529.06 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-1-(2,2-dimethylpropanoylamino)-2-(4-methylanilino)ethenyl]-triphenylphosphanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-1-(2,2-dimethylpropanoylamino)-2-(4-methylanilino)ethenyl]-triphenylphosphanium chloride?
The IUPAC name of [(Z)-1-(2,2-dimethylpropanoylamino)-2-(4-methylanilino)ethenyl]-triphenylphosphanium chloride (CID 45129069) is [(Z)-1-(2,2-dimethylpropanoylamino)-2-(4-methylanilino)ethenyl]-triphenylphosphanium chloride.
What is the SMILES notation for [(Z)-1-(2,2-dimethylpropanoylamino)-2-(4-methylanilino)ethenyl]-triphenylphosphanium chloride?
The canonical SMILES for [(Z)-1-(2,2-dimethylpropanoylamino)-2-(4-methylanilino)ethenyl]-triphenylphosphanium chloride is Cc1ccc(N/C=C(/NC(=O)C(C)(C)C)[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.[Cl-].
What is the InChIKey of [(Z)-1-(2,2-dimethylpropanoylamino)-2-(4-methylanilino)ethenyl]-triphenylphosphanium chloride?
The InChIKey is CLPWHBMINCHMLS-BXMGYBSLSA-N. The full InChI is InChI=1S/C32H33N2OP.ClH/c1-25-20-22-26(23-21-25)33-24-30(34-31(35)32(2,3)4)36(27-14-8-5-9-15-27,28-16-10-6-11-17-28)29-18-12-7-13-19-29;/h5-24,33H,1-4H3;1H/b30-24-;.
What are the key properties of [(Z)-1-(2,2-dimethylpropanoylamino)-2-(4-methylanilino)ethenyl]-triphenylphosphanium chloride?
[(Z)-1-(2,2-dimethylpropanoylamino)-2-(4-methylanilino)ethenyl]-triphenylphosphanium chloride has a molecular weight of 529.06 g/mol, XLogP of 3.37, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-1-(2,2-dimethylpropanoylamino)-2-(4-methylanilino)ethenyl]-triphenylphosphanium chloride is sourced from PubChem (CID 45129069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).