C26H26ClN2O+ — CID 45135263
1-(4-chlorophenyl)-3-(4-phenylphenyl)-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol (PubChem CID 45135263) has the molecular formula C26H26ClN2O+ and a molecular weight of 417.96 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(4-phenylphenyl)-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol.
| Compound Name | 1-(4-chlorophenyl)-3-(4-phenylphenyl)-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol |
|---|---|
| PubChem CID | 45135263 |
| Molecular Formula | C26H26ClN2O+ |
| Molecular Weight | 417.96 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(4-phenylphenyl)-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol |
| SMILES | OC1(c2ccc(-c3ccccc3)cc2)CN(c2ccc(Cl)cc2)C2=[N+]1CCCCC2 |
| InChI | InChI=1S/C26H26ClN2O/c27-23-14-16-24(17-15-23)28-19-26(30,29-18-6-2-5-9-25(28)29)22-12-10-21(11-13-22)20-7-3-1-4-8-20/h1,3-4,7-8,10-17,30H,2,5-6,9,18-19H2/q+1 |
| InChIKey | IHXBNNKSOXYFMA-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.96 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|