About 2-[4-(4-chlorophenyl)-2-(2,3-dimethylphenyl)imino-1,3-thiazol-3-yl]ethanol;hydrobromide
2-[4-(4-chlorophenyl)-2-(2,3-dimethylphenyl)imino-1,3-thiazol-3-yl]ethanol;hydrobromide (PubChem CID 45135380) has the molecular formula C19H20BrClN2OS
and a molecular weight of 439.81 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-2-(2,3-dimethylphenyl)imino-1,3-thiazol-3-yl]ethanol;hydrobromide.
Molecular Properties
| Compound Name | 2-[4-(4-chlorophenyl)-2-(2,3-dimethylphenyl)imino-1,3-thiazol-3-yl]ethanol;hydrobromide |
| PubChem CID | 45135380 |
| Molecular Formula | C19H20BrClN2OS |
| Molecular Weight | 439.81 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-2-(2,3-dimethylphenyl)imino-1,3-thiazol-3-yl]ethanol;hydrobromide |
| SMILES | Br.Cc1cccc(/N=c2\scc(-c3ccc(Cl)cc3)n2CCO)c1C |
| InChI | InChI=1S/C19H19ClN2OS.BrH/c1-13-4-3-5-17(14(13)2)21-19-22(10-11-23)18(12-24-19)15-6-8-16(20)9-7-15;/h3-9,12,23H,10-11H2,1-2H3;1H/b21-19-; |
| InChIKey | KNJWSQZKJCMCRF-WQGAEACMSA-N |
| XLogP | 5.29 |
| TPSA | 37.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.81 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(4-chlorophenyl)-2-(2,3-dimethylphenyl)imino-1,3-thiazol-3-yl]ethanol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-chlorophenyl)-2-(2,3-dimethylphenyl)imino-1,3-thiazol-3-yl]ethanol;hydrobromide?
The IUPAC name of 2-[4-(4-chlorophenyl)-2-(2,3-dimethylphenyl)imino-1,3-thiazol-3-yl]ethanol;hydrobromide (CID 45135380) is 2-[4-(4-chlorophenyl)-2-(2,3-dimethylphenyl)imino-1,3-thiazol-3-yl]ethanol;hydrobromide.
What is the SMILES notation for 2-[4-(4-chlorophenyl)-2-(2,3-dimethylphenyl)imino-1,3-thiazol-3-yl]ethanol;hydrobromide?
The canonical SMILES for 2-[4-(4-chlorophenyl)-2-(2,3-dimethylphenyl)imino-1,3-thiazol-3-yl]ethanol;hydrobromide is Br.Cc1cccc(/N=c2\scc(-c3ccc(Cl)cc3)n2CCO)c1C.
What is the InChIKey of 2-[4-(4-chlorophenyl)-2-(2,3-dimethylphenyl)imino-1,3-thiazol-3-yl]ethanol;hydrobromide?
The InChIKey is KNJWSQZKJCMCRF-WQGAEACMSA-N. The full InChI is InChI=1S/C19H19ClN2OS.BrH/c1-13-4-3-5-17(14(13)2)21-19-22(10-11-23)18(12-24-19)15-6-8-16(20)9-7-15;/h3-9,12,23H,10-11H2,1-2H3;1H/b21-19-;.
What are the key properties of 2-[4-(4-chlorophenyl)-2-(2,3-dimethylphenyl)imino-1,3-thiazol-3-yl]ethanol;hydrobromide?
2-[4-(4-chlorophenyl)-2-(2,3-dimethylphenyl)imino-1,3-thiazol-3-yl]ethanol;hydrobromide has a molecular weight of 439.81 g/mol, XLogP of 5.29, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-chlorophenyl)-2-(2,3-dimethylphenyl)imino-1,3-thiazol-3-yl]ethanol;hydrobromide is sourced from PubChem (CID 45135380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).