About N-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine;hydrobromide
N-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine;hydrobromide (PubChem CID 45135420) has the molecular formula C10H13BrN2O
and a molecular weight of 257.13 g/mol. Its IUPAC name is N-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine;hydrobromide.
Molecular Properties
| Compound Name | N-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine;hydrobromide |
| PubChem CID | 45135420 |
| Molecular Formula | C10H13BrN2O |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | N-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine;hydrobromide |
| SMILES | Br.c1ccc(NC2=NCCOC2)cc1 |
| InChI | InChI=1S/C10H12N2O.BrH/c1-2-4-9(5-3-1)12-10-8-13-7-6-11-10;/h1-5H,6-8H2,(H,11,12);1H |
| InChIKey | INTNVSZMZOHBMK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine;hydrobromide?
The IUPAC name of N-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine;hydrobromide (CID 45135420) is N-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine;hydrobromide.
What is the SMILES notation for N-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine;hydrobromide?
The canonical SMILES for N-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine;hydrobromide is Br.c1ccc(NC2=NCCOC2)cc1.
What is the InChIKey of N-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine;hydrobromide?
The InChIKey is INTNVSZMZOHBMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O.BrH/c1-2-4-9(5-3-1)12-10-8-13-7-6-11-10;/h1-5H,6-8H2,(H,11,12);1H.
What are the key properties of N-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine;hydrobromide?
N-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine;hydrobromide has a molecular weight of 257.13 g/mol, XLogP of 2.11, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-3,6-dihydro-2H-1,4-oxazin-5-amine;hydrobromide is sourced from PubChem (CID 45135420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).