C22H19F7N2OS — CID 45135540
2-[2-(2,3-dimethylphenyl)imino-4-[4-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]-1,3-thiazol-3-yl]ethanol (PubChem CID 45135540) has the molecular formula C22H19F7N2OS and a molecular weight of 492.46 g/mol. Its IUPAC name is 2-[2-(2,3-dimethylphenyl)imino-4-[4-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]-1,3-thiazol-3-yl]ethanol.
| Compound Name | 2-[2-(2,3-dimethylphenyl)imino-4-[4-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]-1,3-thiazol-3-yl]ethanol |
|---|---|
| PubChem CID | 45135540 |
| Molecular Formula | C22H19F7N2OS |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | 2-[2-(2,3-dimethylphenyl)imino-4-[4-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]-1,3-thiazol-3-yl]ethanol |
| SMILES | Cc1cccc(/N=c2\scc(-c3ccc(C(F)(F)C(F)(F)C(F)(F)F)cc3)n2CCO)c1C |
| InChI | InChI=1S/C22H19F7N2OS/c1-13-4-3-5-17(14(13)2)30-19-31(10-11-32)18(12-33-19)15-6-8-16(9-7-15)20(23,24)21(25,26)22(27,28)29/h3-9,12,32H,10-11H2,1-2H3/b30-19- |
| InChIKey | WVCWAKVPLMRRAO-FSGOGVSDSA-N |
| XLogP | 6.35 |
| TPSA | 37.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|