C16H12N6O2S3 — CID 45135768
2-[(3-benzyl-4-oxo-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-7-yl)sulfanyl]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 45135768) has the molecular formula C16H12N6O2S3 and a molecular weight of 416.51 g/mol. Its IUPAC name is 2-[(3-benzyl-4-oxo-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-7-yl)sulfanyl]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[(3-benzyl-4-oxo-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-7-yl)sulfanyl]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 45135768 |
| Molecular Formula | C16H12N6O2S3 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | 2-[(3-benzyl-4-oxo-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-7-yl)sulfanyl]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CSc1nn2c(=O)c(Cc3ccccc3)nnc2s1)Nc1nccs1 |
| InChI | InChI=1S/C16H12N6O2S3/c23-12(18-14-17-6-7-25-14)9-26-16-21-22-13(24)11(19-20-15(22)27-16)8-10-4-2-1-3-5-10/h1-7H,8-9H2,(H,17,18,23) |
| InChIKey | CMNAEXKQIGMVCA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |