C16H16N4OS — CID 45136852
6-(3,6-dihydro-2H-pyridin-1-ylmethyl)-2-(furan-2-yl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 45136852) has the molecular formula C16H16N4OS and a molecular weight of 312.40 g/mol. Its IUPAC name is 6-(3,6-dihydro-2H-pyridin-1-ylmethyl)-2-(furan-2-yl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-(3,6-dihydro-2H-pyridin-1-ylmethyl)-2-(furan-2-yl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 45136852 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 6-(3,6-dihydro-2H-pyridin-1-ylmethyl)-2-(furan-2-yl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1nc(-c2ccco2)nc2sc(CN3CC=CCC3)cc12 |
| InChI | InChI=1S/C16H16N4OS/c17-14-12-9-11(10-20-6-2-1-3-7-20)22-16(12)19-15(18-14)13-5-4-8-21-13/h1-2,4-5,8-9H,3,6-7,10H2,(H2,17,18,19) |
| InChIKey | DHPWIFQARXXGQJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|