C20H25ClN2O2 — CID 45137622
7-chloro-9-methyl-4-(propylamino)spiro[3,4-dihydropyrano[2,3-g]quinoline-2,1'-cyclopentane]-3-ol (PubChem CID 45137622) has the molecular formula C20H25ClN2O2 and a molecular weight of 360.89 g/mol. Its IUPAC name is 7-chloro-9-methyl-4-(propylamino)spiro[3,4-dihydropyrano[2,3-g]quinoline-2,1'-cyclopentane]-3-ol.
| Compound Name | 7-chloro-9-methyl-4-(propylamino)spiro[3,4-dihydropyrano[2,3-g]quinoline-2,1'-cyclopentane]-3-ol |
|---|---|
| PubChem CID | 45137622 |
| Molecular Formula | C20H25ClN2O2 |
| Molecular Weight | 360.89 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 7-chloro-9-methyl-4-(propylamino)spiro[3,4-dihydropyrano[2,3-g]quinoline-2,1'-cyclopentane]-3-ol |
| SMILES | CCCNC1c2cc3nc(Cl)cc(C)c3cc2OC2(CCCC2)C1O |
| InChI | InChI=1S/C20H25ClN2O2/c1-3-8-22-18-14-10-15-13(12(2)9-17(21)23-15)11-16(14)25-20(19(18)24)6-4-5-7-20/h9-11,18-19,22,24H,3-8H2,1-2H3 |
| InChIKey | GTMASOJBGFNRBE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.89 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|