C19H21N5O3 — CID 45137730
N-[6-(2-aminoanilino)-6-oxohexyl]-2,1,3-benzoxadiazole-5-carboxamide (PubChem CID 45137730) has the molecular formula C19H21N5O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is N-[6-(2-aminoanilino)-6-oxohexyl]-2,1,3-benzoxadiazole-5-carboxamide.
| Compound Name | N-[6-(2-aminoanilino)-6-oxohexyl]-2,1,3-benzoxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 45137730 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N-[6-(2-aminoanilino)-6-oxohexyl]-2,1,3-benzoxadiazole-5-carboxamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCNC(=O)c1ccc2nonc2c1 |
| InChI | InChI=1S/C19H21N5O3/c20-14-6-3-4-7-15(14)22-18(25)8-2-1-5-11-21-19(26)13-9-10-16-17(12-13)24-27-23-16/h3-4,6-7,9-10,12H,1-2,5,8,11,20H2,(H,21,26)(H,22,25) |
| InChIKey | LAYURGNLJVCMOR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|