C28H25NO5S — CID 45138181
methyl (E)-3-(3,5-dimethylphenyl)-2-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]phenyl]prop-2-enoate (PubChem CID 45138181) has the molecular formula C28H25NO5S and a molecular weight of 487.58 g/mol. Its IUPAC name is methyl (E)-3-(3,5-dimethylphenyl)-2-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-(3,5-dimethylphenyl)-2-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 45138181 |
| Molecular Formula | C28H25NO5S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | methyl (E)-3-(3,5-dimethylphenyl)-2-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C(=C/c1cc(C)cc(C)c1)c1cccc(Oc2ccc(CC3SC(=O)NC3=O)cc2)c1 |
| InChI | InChI=1S/C28H25NO5S/c1-17-11-18(2)13-20(12-17)14-24(27(31)33-3)21-5-4-6-23(16-21)34-22-9-7-19(8-10-22)15-25-26(30)29-28(32)35-25/h4-14,16,25H,15H2,1-3H3,(H,29,30,32)/b24-14+ |
| InChIKey | UNAHOWHDITXMPL-ZVHZXABRSA-N |
| XLogP | 5.70 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|