C27H39N3O — CID 45138880
(2E,4E,6E,8E)-N-tert-butyl-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenamide (PubChem CID 45138880) has the molecular formula C27H39N3O and a molecular weight of 421.63 g/mol. Its IUPAC name is (2E,4E,6E,8E)-N-tert-butyl-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenamide.
| Compound Name | (2E,4E,6E,8E)-N-tert-butyl-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 45138880 |
| Molecular Formula | C27H39N3O |
| Molecular Weight | 421.63 g/mol |
| Exact Mass | 421.31 |
| IUPAC Name | (2E,4E,6E,8E)-N-tert-butyl-9-(3-imidazol-1-yl-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenamide |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)NC(C)(C)C)C(C)(C)CCC1n1ccnc1 |
| InChI | InChI=1S/C27H39N3O/c1-20(10-9-11-21(2)18-25(31)29-26(4,5)6)12-13-23-22(3)24(14-15-27(23,7)8)30-17-16-28-19-30/h9-13,16-19,24H,14-15H2,1-8H3,(H,29,31)/b11-9+,13-12+,20-10+,21-18+ |
| InChIKey | VURSCUCMUUMLTQ-CBVDPVLBSA-N |
| XLogP | 6.48 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.63 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|