C26H37NO6 — CID 45139032
(Z)-N-(1,3-dihydroxypropan-2-yl)-7-[(1R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]-5-oxocyclopentyl]hept-5-enamide (PubChem CID 45139032) has the molecular formula C26H37NO6 and a molecular weight of 459.58 g/mol. Its IUPAC name is (Z)-N-(1,3-dihydroxypropan-2-yl)-7-[(1R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]-5-oxocyclopentyl]hept-5-enamide.
| Compound Name | (Z)-N-(1,3-dihydroxypropan-2-yl)-7-[(1R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]-5-oxocyclopentyl]hept-5-enamide |
|---|---|
| PubChem CID | 45139032 |
| Molecular Formula | C26H37NO6 |
| Molecular Weight | 459.58 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | (Z)-N-(1,3-dihydroxypropan-2-yl)-7-[(1R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]-5-oxocyclopentyl]hept-5-enamide |
| SMILES | O=C(CCC/C=C\C[C@H]1C(=O)C[C@@H](O)C1/C=C/[C@@H](O)CCc1ccccc1)NC(CO)CO |
| InChI | InChI=1S/C26H37NO6/c28-17-20(18-29)27-26(33)11-7-2-1-6-10-22-23(25(32)16-24(22)31)15-14-21(30)13-12-19-8-4-3-5-9-19/h1,3-6,8-9,14-15,20-23,25,28-30,32H,2,7,10-13,16-18H2,(H,27,33)/b6-1-,15-14+/t21-,22+,23?,25+/m0/s1 |
| InChIKey | NYRITJWASKBGOC-YNIOAQSFSA-N |
| XLogP | 1.69 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.58 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|