C23H20F2N4O — CID 45139205
2,10-difluoro-6-methoxy-12-piperazin-1-yl-5,7-dihydroindolo[2,3-b]carbazole (PubChem CID 45139205) has the molecular formula C23H20F2N4O and a molecular weight of 406.44 g/mol. Its IUPAC name is 2,10-difluoro-6-methoxy-12-piperazin-1-yl-5,7-dihydroindolo[2,3-b]carbazole.
| Compound Name | 2,10-difluoro-6-methoxy-12-piperazin-1-yl-5,7-dihydroindolo[2,3-b]carbazole |
|---|---|
| PubChem CID | 45139205 |
| Molecular Formula | C23H20F2N4O |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 2,10-difluoro-6-methoxy-12-piperazin-1-yl-5,7-dihydroindolo[2,3-b]carbazole |
| SMILES | COc1c2[nH]c3ccc(F)cc3c2c(N2CCNCC2)c2c1[nH]c1ccc(F)cc12 |
| InChI | InChI=1S/C23H20F2N4O/c1-30-23-20-18(14-10-12(24)2-4-16(14)27-20)22(29-8-6-26-7-9-29)19-15-11-13(25)3-5-17(15)28-21(19)23/h2-5,10-11,26-28H,6-9H2,1H3 |
| InChIKey | GPBWPWVINTXYBC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 56.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|