C17H22N6O2 — CID 45139427
8-(cyclopentylamino)-N-hydroxy-N,1-dimethyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxamide (PubChem CID 45139427) has the molecular formula C17H22N6O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 8-(cyclopentylamino)-N-hydroxy-N,1-dimethyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxamide.
| Compound Name | 8-(cyclopentylamino)-N-hydroxy-N,1-dimethyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxamide |
|---|---|
| PubChem CID | 45139427 |
| Molecular Formula | C17H22N6O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 8-(cyclopentylamino)-N-hydroxy-N,1-dimethyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxamide |
| SMILES | CN(O)C(=O)c1nn(C)c2c1CCc1cnc(NC3CCCC3)nc1-2 |
| InChI | InChI=1S/C17H22N6O2/c1-22-15-12(14(21-22)16(24)23(2)25)8-7-10-9-18-17(20-13(10)15)19-11-5-3-4-6-11/h9,11,25H,3-8H2,1-2H3,(H,18,19,20) |
| InChIKey | GMMJFFFHKSLXFV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|