C22H30N6O2 — CID 45139428
N-cyclohexyl-8-(cyclopentylamino)-N-hydroxy-1-methyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxamide (PubChem CID 45139428) has the molecular formula C22H30N6O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is N-cyclohexyl-8-(cyclopentylamino)-N-hydroxy-1-methyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxamide.
| Compound Name | N-cyclohexyl-8-(cyclopentylamino)-N-hydroxy-1-methyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxamide |
|---|---|
| PubChem CID | 45139428 |
| Molecular Formula | C22H30N6O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | N-cyclohexyl-8-(cyclopentylamino)-N-hydroxy-1-methyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxamide |
| SMILES | Cn1nc(C(=O)N(O)C2CCCCC2)c2c1-c1nc(NC3CCCC3)ncc1CC2 |
| InChI | InChI=1S/C22H30N6O2/c1-27-20-17(19(26-27)21(29)28(30)16-9-3-2-4-10-16)12-11-14-13-23-22(25-18(14)20)24-15-7-5-6-8-15/h13,15-16,30H,2-12H2,1H3,(H,23,24,25) |
| InChIKey | ALXPUKLGPACDFZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|