About (1S,2R)-1-(2,3-dihydroindol-1-yl)-3-(methylamino)-1-phenylpropan-2-ol;hydrochloride
(1S,2R)-1-(2,3-dihydroindol-1-yl)-3-(methylamino)-1-phenylpropan-2-ol;hydrochloride (PubChem CID 45139777) has the molecular formula C18H23ClN2O
and a molecular weight of 318.85 g/mol. Its IUPAC name is (1S,2R)-1-(2,3-dihydroindol-1-yl)-3-(methylamino)-1-phenylpropan-2-ol;hydrochloride.
Molecular Properties
| Compound Name | (1S,2R)-1-(2,3-dihydroindol-1-yl)-3-(methylamino)-1-phenylpropan-2-ol;hydrochloride |
| PubChem CID | 45139777 |
| Molecular Formula | C18H23ClN2O |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | (1S,2R)-1-(2,3-dihydroindol-1-yl)-3-(methylamino)-1-phenylpropan-2-ol;hydrochloride |
| SMILES | CNC[C@@H](O)[C@H](c1ccccc1)N1CCc2ccccc21.Cl |
| InChI | InChI=1S/C18H22N2O.ClH/c1-19-13-17(21)18(15-8-3-2-4-9-15)20-12-11-14-7-5-6-10-16(14)20;/h2-10,17-19,21H,11-13H2,1H3;1H/t17-,18+;/m1./s1 |
| InChIKey | JLWSMMAHZFKYJR-URBRKQAFSA-N |
| XLogP | 2.79 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S,2R)-1-(2,3-dihydroindol-1-yl)-3-(methylamino)-1-phenylpropan-2-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2R)-1-(2,3-dihydroindol-1-yl)-3-(methylamino)-1-phenylpropan-2-ol;hydrochloride?
The IUPAC name of (1S,2R)-1-(2,3-dihydroindol-1-yl)-3-(methylamino)-1-phenylpropan-2-ol;hydrochloride (CID 45139777) is (1S,2R)-1-(2,3-dihydroindol-1-yl)-3-(methylamino)-1-phenylpropan-2-ol;hydrochloride.
What is the SMILES notation for (1S,2R)-1-(2,3-dihydroindol-1-yl)-3-(methylamino)-1-phenylpropan-2-ol;hydrochloride?
The canonical SMILES for (1S,2R)-1-(2,3-dihydroindol-1-yl)-3-(methylamino)-1-phenylpropan-2-ol;hydrochloride is CNC[C@@H](O)[C@H](c1ccccc1)N1CCc2ccccc21.Cl.
What is the InChIKey of (1S,2R)-1-(2,3-dihydroindol-1-yl)-3-(methylamino)-1-phenylpropan-2-ol;hydrochloride?
The InChIKey is JLWSMMAHZFKYJR-URBRKQAFSA-N. The full InChI is InChI=1S/C18H22N2O.ClH/c1-19-13-17(21)18(15-8-3-2-4-9-15)20-12-11-14-7-5-6-10-16(14)20;/h2-10,17-19,21H,11-13H2,1H3;1H/t17-,18+;/m1./s1.
What are the key properties of (1S,2R)-1-(2,3-dihydroindol-1-yl)-3-(methylamino)-1-phenylpropan-2-ol;hydrochloride?
(1S,2R)-1-(2,3-dihydroindol-1-yl)-3-(methylamino)-1-phenylpropan-2-ol;hydrochloride has a molecular weight of 318.85 g/mol, XLogP of 2.79, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2R)-1-(2,3-dihydroindol-1-yl)-3-(methylamino)-1-phenylpropan-2-ol;hydrochloride is sourced from PubChem (CID 45139777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).